C27H33F3N8O6S3 — CID 22848485
(2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]sulfonylamino]propanamide;sulfurous acid (PubChem CID 22848485) has the molecular formula C27H33F3N8O6S3 and a molecular weight of 718.81 g/mol. Its IUPAC name is (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]sulfonylamino]propanamide;sulfurous acid.
| Compound Name | (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]sulfonylamino]propanamide;sulfurous acid |
|---|---|
| PubChem CID | 22848485 |
| Molecular Formula | C27H33F3N8O6S3 |
| Molecular Weight | 718.81 g/mol |
| Exact Mass | 718.16 |
| IUPAC Name | (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]sulfonylamino]propanamide;sulfurous acid |
| SMILES | O=S(O)O.[H]/N=C(\N)N1CCCC(CNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NS(=O)(=O)c2ccc(-c3cc(C(F)(F)F)n(C)n3)s2)C1 |
| InChI | InChI=1S/C27H31F3N8O3S2.H2O3S/c1-37-23(27(28,29)30)12-20(35-37)22-8-9-24(42-22)43(40,41)36-21(11-17-14-33-19-7-3-2-6-18(17)19)25(39)34-13-16-5-4-10-38(15-16)26(31)32;1-4(2)3/h2-3,6-9,12,14,16,21,33,36H,4-5,10-11,13,15H2,1H3,(H3,31,32)(H,34,39);(H2,1,2,3)/t16?,21-;/m1./s1 |
| InChIKey | IUYIIXWFGUFEEC-QDCIUMTQSA-N |
| XLogP | 2.94 |
| TPSA | 219.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|