C8H8ClNO5S — CID 22848771
(6S,7S)-7-chloro-3-methyl-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22848771) has the molecular formula C8H8ClNO5S and a molecular weight of 265.67 g/mol. Its IUPAC name is (6S,7S)-7-chloro-3-methyl-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7S)-7-chloro-3-methyl-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22848771 |
| Molecular Formula | C8H8ClNO5S |
| Molecular Weight | 265.67 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | (6S,7S)-7-chloro-3-methyl-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC1=C(C(=O)O)N2C(=O)[C@H](Cl)[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C8H8ClNO5S/c1-3-2-16(14,15)7-4(9)6(11)10(7)5(3)8(12)13/h4,7H,2H2,1H3,(H,12,13)/t4-,7-/m0/s1 |
| InChIKey | UVICYMCDMGXYCN-FFWSUHOLSA-N |
| XLogP | -0.45 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.67 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|