C21H38O2Si — CID 22848927
tert-butyl-dimethyl-[(2S,3R,5S)-5-methyl-2-[(1E,3E,5E)-nona-1,3,5-trienyl]oxan-3-yl]oxysilane (PubChem CID 22848927) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S,3R,5S)-5-methyl-2-[(1E,3E,5E)-nona-1,3,5-trienyl]oxan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S,3R,5S)-5-methyl-2-[(1E,3E,5E)-nona-1,3,5-trienyl]oxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 22848927 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl-dimethyl-[(2S,3R,5S)-5-methyl-2-[(1E,3E,5E)-nona-1,3,5-trienyl]oxan-3-yl]oxysilane |
| SMILES | CCC/C=C/C=C/C=C/[C@@H]1OC[C@@H](C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-8-9-10-11-12-13-14-15-19-20(16-18(2)17-22-19)23-24(6,7)21(3,4)5/h10-15,18-20H,8-9,16-17H2,1-7H3/b11-10+,13-12+,15-14+/t18-,19-,20+/m0/s1 |
| InChIKey | KVLFMSJXWFSWAE-DMJOFOQTSA-N |
| XLogP | 6.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|