C23H34O4 — CID 22849487
(2'R,11'S,12'S,15'S,16'S)-5,5,16'-trimethylspiro[1,3-dioxane-2,6'-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-1(18)-ene]-15'-ol (PubChem CID 22849487) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (2'R,11'S,12'S,15'S,16'S)-5,5,16'-trimethylspiro[1,3-dioxane-2,6'-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-1(18)-ene]-15'-ol.
| Compound Name | (2'R,11'S,12'S,15'S,16'S)-5,5,16'-trimethylspiro[1,3-dioxane-2,6'-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-1(18)-ene]-15'-ol |
|---|---|
| PubChem CID | 22849487 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (2'R,11'S,12'S,15'S,16'S)-5,5,16'-trimethylspiro[1,3-dioxane-2,6'-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-1(18)-ene]-15'-ol |
| SMILES | CC1(C)COC2(CC3CC[C@@H]4C(=CC[C@]5(C)[C@@H](O)CC[C@@H]45)[C@@H]3C3OC32)OC1 |
| InChI | InChI=1S/C23H34O4/c1-21(2)11-25-23(26-12-21)10-13-4-5-14-15(18(13)19-20(23)27-19)8-9-22(3)16(14)6-7-17(22)24/h8,13-14,16-20,24H,4-7,9-12H2,1-3H3/t13?,14-,16+,17+,18-,19?,20?,22+/m1/s1 |
| InChIKey | XCYKSMFSFOHZET-GHJZSLEESA-N |
| XLogP | 3.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|