C27H30BrF3N2O — CID 22849605
(S)-[(2R,4S,5R)-5-ethyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide (PubChem CID 22849605) has the molecular formula C27H30BrF3N2O and a molecular weight of 535.45 g/mol. Its IUPAC name is (S)-[(2R,4S,5R)-5-ethyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide.
| Compound Name | (S)-[(2R,4S,5R)-5-ethyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide |
|---|---|
| PubChem CID | 22849605 |
| Molecular Formula | C27H30BrF3N2O |
| Molecular Weight | 535.45 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | (S)-[(2R,4S,5R)-5-ethyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide |
| SMILES | CC[C@H]1C[N+]2(Cc3ccc(C(F)(F)F)cc3)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12.[Br-] |
| InChI | InChI=1S/C27H30F3N2O.BrH/c1-2-19-17-32(16-18-7-9-21(10-8-18)27(28,29)30)14-12-20(19)15-25(32)26(33)23-11-13-31-24-6-4-3-5-22(23)24;/h3-11,13,19-20,25-26,33H,2,12,14-17H2,1H3;1H/q+1;/p-1/t19-,20-,25+,26-,32?;/m0./s1 |
| InChIKey | HBCBNLQWGUZFKC-KFGLDPKJSA-M |
| XLogP | 3.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|