C23H34N2O2 — CID 22849622
2-methyl-N-[(2S)-1-[(5-methyl-2-propan-2-ylcyclohexyl)amino]-1-oxo-3-phenylpropan-2-yl]prop-2-enamide (PubChem CID 22849622) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 2-methyl-N-[(2S)-1-[(5-methyl-2-propan-2-ylcyclohexyl)amino]-1-oxo-3-phenylpropan-2-yl]prop-2-enamide.
| Compound Name | 2-methyl-N-[(2S)-1-[(5-methyl-2-propan-2-ylcyclohexyl)amino]-1-oxo-3-phenylpropan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 22849622 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 2-methyl-N-[(2S)-1-[(5-methyl-2-propan-2-ylcyclohexyl)amino]-1-oxo-3-phenylpropan-2-yl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)NC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C23H34N2O2/c1-15(2)19-12-11-17(5)13-20(19)24-23(27)21(25-22(26)16(3)4)14-18-9-7-6-8-10-18/h6-10,15,17,19-21H,3,11-14H2,1-2,4-5H3,(H,24,27)(H,25,26)/t17?,19?,20?,21-/m0/s1 |
| InChIKey | KZGNYLFQTOAJOK-SLQSYFLNSA-N |
| XLogP | 3.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|