C31H36N4O10S — CID 22850260
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(4-methylphenyl)sulfonyloxy-2-oct-1-ynylpurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 22850260) has the molecular formula C31H36N4O10S and a molecular weight of 656.71 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(4-methylphenyl)sulfonyloxy-2-oct-1-ynylpurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(4-methylphenyl)sulfonyloxy-2-oct-1-ynylpurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22850260 |
| Molecular Formula | C31H36N4O10S |
| Molecular Weight | 656.71 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(4-methylphenyl)sulfonyloxy-2-oct-1-ynylpurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CCCCCCC#Cc1nc(OS(=O)(=O)c2ccc(C)cc2)c2ncn([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]3OC(C)=O)c2n1 |
| InChI | InChI=1S/C31H36N4O10S/c1-6-7-8-9-10-11-12-25-33-29-26(30(34-25)45-46(39,40)23-15-13-19(2)14-16-23)32-18-35(29)31-28(43-22(5)38)27(42-21(4)37)24(44-31)17-41-20(3)36/h13-16,18,24,27-28,31H,6-10,17H2,1-5H3/t24-,27-,28-,31-/m1/s1 |
| InChIKey | DVCQUJHFAMPYKR-GUYMFIDCSA-N |
| XLogP | 3.55 |
| TPSA | 175.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|