C23H25N5O10S — CID 22850262
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-amino-6-(4-methylphenyl)sulfonyloxypurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 22850262) has the molecular formula C23H25N5O10S and a molecular weight of 563.55 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-amino-6-(4-methylphenyl)sulfonyloxypurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-amino-6-(4-methylphenyl)sulfonyloxypurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22850262 |
| Molecular Formula | C23H25N5O10S |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-amino-6-(4-methylphenyl)sulfonyloxypurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(OS(=O)(=O)c4ccc(C)cc4)nc(N)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H25N5O10S/c1-11-5-7-15(8-6-11)39(32,33)38-21-17-20(26-23(24)27-21)28(10-25-17)22-19(36-14(4)31)18(35-13(3)30)16(37-22)9-34-12(2)29/h5-8,10,16,18-19,22H,9H2,1-4H3,(H2,24,26,27)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | ZPZPJNZLETTXPP-WGQQHEPDSA-N |
| XLogP | 0.81 |
| TPSA | 201.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|