C20H30O3 — CID 22850284
(3aS,4S,5R,6aS)-5-hydroxy-4-[(1E,3S)-3-hydroxy-9-methyldeca-1,8-dienyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one (PubChem CID 22850284) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-5-hydroxy-4-[(1E,3S)-3-hydroxy-9-methyldeca-1,8-dienyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one.
| Compound Name | (3aS,4S,5R,6aS)-5-hydroxy-4-[(1E,3S)-3-hydroxy-9-methyldeca-1,8-dienyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 22850284 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3aS,4S,5R,6aS)-5-hydroxy-4-[(1E,3S)-3-hydroxy-9-methyldeca-1,8-dienyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
| SMILES | C=C1C[C@H]2[C@H](/C=C/[C@@H](O)CCCCC=C(C)C)[C@H](O)C[C@@H]2C1=O |
| InChI | InChI=1S/C20H30O3/c1-13(2)7-5-4-6-8-15(21)9-10-16-17-11-14(3)20(23)18(17)12-19(16)22/h7,9-10,15-19,21-22H,3-6,8,11-12H2,1-2H3/b10-9+/t15-,16-,17-,18-,19+/m0/s1 |
| InChIKey | RHQGRERSDDKVMP-NQQUCPGWSA-N |
| XLogP | 3.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|