C16H24O4 — CID 22850286
(3aS,4S,5R,6aS)-4-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-5-hydroxy-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one (PubChem CID 22850286) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-4-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-5-hydroxy-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one.
| Compound Name | (3aS,4S,5R,6aS)-4-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-5-hydroxy-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 22850286 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (3aS,4S,5R,6aS)-4-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-5-hydroxy-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
| SMILES | C=C1C[C@H]2[C@H](/C=C/[C@@H](O)CCOCC)[C@H](O)C[C@@H]2C1=O |
| InChI | InChI=1S/C16H24O4/c1-3-20-7-6-11(17)4-5-12-13-8-10(2)16(19)14(13)9-15(12)18/h4-5,11-15,17-18H,2-3,6-9H2,1H3/b5-4+/t11-,12+,13+,14+,15-/m1/s1 |
| InChIKey | XZZJCEMNLIQFCL-KJGXOXHESA-N |
| XLogP | 1.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|