C33H62O4Si2 — CID 22850292
[(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl] acetate (PubChem CID 22850292) has the molecular formula C33H62O4Si2 and a molecular weight of 579.03 g/mol. Its IUPAC name is [(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl] acetate.
| Compound Name | [(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl] acetate |
|---|---|
| PubChem CID | 22850292 |
| Molecular Formula | C33H62O4Si2 |
| Molecular Weight | 579.03 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | [(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl] acetate |
| SMILES | C=C1C[C@@H]2[C@H](/C=C/[C@H](C[C@@H](C)CCCC)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C1OC(C)=O |
| InChI | InChI=1S/C33H62O4Si2/c1-15-16-17-23(2)20-26(36-38(11,12)32(5,6)7)18-19-27-28-21-24(3)31(35-25(4)34)29(28)22-30(27)37-39(13,14)33(8,9)10/h18-19,23,26-31H,3,15-17,20-22H2,1-2,4-14H3/b19-18+/t23-,26+,27-,28+,29-,30+,31?/m0/s1 |
| InChIKey | DGGORAPTGYBODQ-PXUUFDGHSA-N |
| XLogP | 9.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.03 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|