C29H54O3Si2 — CID 22850299
(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol (PubChem CID 22850299) has the molecular formula C29H54O3Si2 and a molecular weight of 506.92 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol.
| Compound Name | (3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol |
|---|---|
| PubChem CID | 22850299 |
| Molecular Formula | C29H54O3Si2 |
| Molecular Weight | 506.92 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | (3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol |
| SMILES | C=C1C[C@@H]2[C@H](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)C3CCCC3)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C1O |
| InChI | InChI=1S/C29H54O3Si2/c1-20-18-23-22(26(19-24(23)27(20)30)32-34(10,11)29(5,6)7)16-17-25(21-14-12-13-15-21)31-33(8,9)28(2,3)4/h16-17,21-27,30H,1,12-15,18-19H2,2-11H3/b17-16+/t22-,23+,24-,25+,26+,27?/m0/s1 |
| InChIKey | PYPNMYXZMUKAIT-GSZPZRDMSA-N |
| XLogP | 8.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.92 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|