C31H60O3Si2 — CID 22850302
(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol (PubChem CID 22850302) has the molecular formula C31H60O3Si2 and a molecular weight of 536.99 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol.
| Compound Name | (3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol |
|---|---|
| PubChem CID | 22850302 |
| Molecular Formula | C31H60O3Si2 |
| Molecular Weight | 536.99 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | (3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol |
| SMILES | C=C1C[C@@H]2[C@H](/C=C/C(O[Si](C)(C)C(C)(C)C)C(C)(C)CCCC)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C1O |
| InChI | InChI=1S/C31H60O3Si2/c1-15-16-19-31(9,10)27(34-36(13,14)30(6,7)8)18-17-23-24-20-22(2)28(32)25(24)21-26(23)33-35(11,12)29(3,4)5/h17-18,23-28,32H,2,15-16,19-21H2,1,3-14H3/b18-17+/t23-,24+,25-,26+,27?,28?/m0/s1 |
| InChIKey | WOAGGLDSUFHMIS-CZVSYQQKSA-N |
| XLogP | 9.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.99 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|