C30H54O3Si2 — CID 22850308
(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one (PubChem CID 22850308) has the molecular formula C30H54O3Si2 and a molecular weight of 518.93 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one.
| Compound Name | (3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 22850308 |
| Molecular Formula | C30H54O3Si2 |
| Molecular Weight | 518.93 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | (3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
| SMILES | C=C1C[C@H]2[C@H](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)C3CCCCC3)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C1=O |
| InChI | InChI=1S/C30H54O3Si2/c1-21-19-24-23(27(20-25(24)28(21)31)33-35(10,11)30(5,6)7)17-18-26(22-15-13-12-14-16-22)32-34(8,9)29(2,3)4/h17-18,22-27H,1,12-16,19-20H2,2-11H3/b18-17+/t23-,24-,25-,26+,27+/m0/s1 |
| InChIKey | ABKMNSWHHHXPMQ-XMAQMYBASA-N |
| XLogP | 8.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.93 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|