C30H58O3Si2 — CID 22850336
(3aS,4S,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-4-[butyl(dimethyl)silyl]oxy-4-methyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol (PubChem CID 22850336) has the molecular formula C30H58O3Si2 and a molecular weight of 522.96 g/mol. Its IUPAC name is (3aS,4S,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-4-[butyl(dimethyl)silyl]oxy-4-methyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol.
| Compound Name | (3aS,4S,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-4-[butyl(dimethyl)silyl]oxy-4-methyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol |
|---|---|
| PubChem CID | 22850336 |
| Molecular Formula | C30H58O3Si2 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.39 |
| IUPAC Name | (3aS,4S,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-4-[butyl(dimethyl)silyl]oxy-4-methyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-ol |
| SMILES | C=C1C[C@@H]2[C@H](/C=C/CC(C)(CCCC)O[Si](C)(C)CCCC)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C1O |
| InChI | InChI=1S/C30H58O3Si2/c1-12-14-18-30(7,33-34(8,9)20-15-13-2)19-16-17-24-25-21-23(3)28(31)26(25)22-27(24)32-35(10,11)29(4,5)6/h16-17,24-28,31H,3,12-15,18-22H2,1-2,4-11H3/b17-16+/t24-,25+,26-,27-,28?,30?/m0/s1 |
| InChIKey | RBDIBAXVCKQUHH-DQBLTUEMSA-N |
| XLogP | 8.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|