C27H24N2O3 — CID 2285039
(5S)-3,3-dimethyl-5-[(E)-2-(2-nitrophenyl)ethenyl]-2,4,5,6-tetrahydrobenzo[a]phenanthridin-1-one (PubChem CID 2285039) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is (5S)-3,3-dimethyl-5-[(E)-2-(2-nitrophenyl)ethenyl]-2,4,5,6-tetrahydrobenzo[a]phenanthridin-1-one.
| Compound Name | (5S)-3,3-dimethyl-5-[(E)-2-(2-nitrophenyl)ethenyl]-2,4,5,6-tetrahydrobenzo[a]phenanthridin-1-one |
|---|---|
| PubChem CID | 2285039 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (5S)-3,3-dimethyl-5-[(E)-2-(2-nitrophenyl)ethenyl]-2,4,5,6-tetrahydrobenzo[a]phenanthridin-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)[C@H](/C=C/c1ccccc1[N+](=O)[O-])Nc1ccc3ccccc3c12 |
| InChI | InChI=1S/C27H24N2O3/c1-27(2)15-20-21(13-12-18-8-4-6-10-23(18)29(31)32)28-22-14-11-17-7-3-5-9-19(17)25(22)26(20)24(30)16-27/h3-14,21,28H,15-16H2,1-2H3/b13-12+/t21-/m0/s1 |
| InChIKey | IYGRCVQNNUUTOS-IWGBCORSSA-N |
| XLogP | 6.40 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|