About (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one
(3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one (PubChem CID 22850705) has the molecular formula C7H12O2S2
and a molecular weight of 192.30 g/mol. Its IUPAC name is (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one.
Molecular Properties
| Compound Name | (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one |
| PubChem CID | 22850705 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one |
| SMILES | C[C@@H]1C(CS)OC(=O)[C@@H]1CS |
| InChI | InChI=1S/C7H12O2S2/c1-4-5(2-10)7(8)9-6(4)3-11/h4-6,10-11H,2-3H2,1H3/t4-,5+,6?/m0/s1 |
| InChIKey | KQQITFMEXDIACJ-YRZWDFBDSA-N |
| XLogP | 1.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one?
The IUPAC name of (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one (CID 22850705) is (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one.
What is the SMILES notation for (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one?
The canonical SMILES for (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one is C[C@@H]1C(CS)OC(=O)[C@@H]1CS.
What is the InChIKey of (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one?
The InChIKey is KQQITFMEXDIACJ-YRZWDFBDSA-N. The full InChI is InChI=1S/C7H12O2S2/c1-4-5(2-10)7(8)9-6(4)3-11/h4-6,10-11H,2-3H2,1H3/t4-,5+,6?/m0/s1.
What are the key properties of (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one?
(3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one has a molecular weight of 192.30 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one is sourced from PubChem (CID 22850705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).