About (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one
(3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one (PubChem CID 22850708) has the molecular formula C6H10O2S2
and a molecular weight of 178.28 g/mol. Its IUPAC name is (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one.
Molecular Properties
| Compound Name | (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one |
| PubChem CID | 22850708 |
| Molecular Formula | C6H10O2S2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one |
| SMILES | O=C1O[C@H](CS)C[C@H]1CS |
| InChI | InChI=1S/C6H10O2S2/c7-6-4(2-9)1-5(3-10)8-6/h4-5,9-10H,1-3H2/t4-,5-/m0/s1 |
| InChIKey | AAFQPMAIGSTFGN-WHFBIAKZSA-N |
| XLogP | 0.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one?
The IUPAC name of (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one (CID 22850708) is (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one.
What is the SMILES notation for (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one?
The canonical SMILES for (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one is O=C1O[C@H](CS)C[C@H]1CS.
What is the InChIKey of (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one?
The InChIKey is AAFQPMAIGSTFGN-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H10O2S2/c7-6-4(2-9)1-5(3-10)8-6/h4-5,9-10H,1-3H2/t4-,5-/m0/s1.
What are the key properties of (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one?
(3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one has a molecular weight of 178.28 g/mol, XLogP of 0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-3,5-bis(sulfanylmethyl)oxolan-2-one is sourced from PubChem (CID 22850708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).