C25H38N2O9SSi — CID 22850820
[(5R,8S)-16-[tert-butyl(dimethyl)silyl]oxy-14-ethoxy-5-methoxycarbonyl-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-trien-8-yl]carbamic acid (PubChem CID 22850820) has the molecular formula C25H38N2O9SSi and a molecular weight of 570.74 g/mol. Its IUPAC name is [(5R,8S)-16-[tert-butyl(dimethyl)silyl]oxy-14-ethoxy-5-methoxycarbonyl-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-trien-8-yl]carbamic acid.
| Compound Name | [(5R,8S)-16-[tert-butyl(dimethyl)silyl]oxy-14-ethoxy-5-methoxycarbonyl-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-trien-8-yl]carbamic acid |
|---|---|
| PubChem CID | 22850820 |
| Molecular Formula | C25H38N2O9SSi |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | [(5R,8S)-16-[tert-butyl(dimethyl)silyl]oxy-14-ethoxy-5-methoxycarbonyl-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-trien-8-yl]carbamic acid |
| SMILES | CCOc1cc(O[Si](C)(C)C(C)(C)C)c2c(c1C)C(=O)OC[C@H](NC(=O)O)C(=O)N[C@H](C(=O)OC)CSC2 |
| InChI | InChI=1S/C25H38N2O9SSi/c1-9-34-18-10-19(36-38(7,8)25(3,4)5)15-12-37-13-17(22(29)33-6)26-21(28)16(27-24(31)32)11-35-23(30)20(15)14(18)2/h10,16-17,27H,9,11-13H2,1-8H3,(H,26,28)(H,31,32)/t16-,17-/m0/s1 |
| InChIKey | MCQWTEKNWKJCOX-IRXDYDNUSA-N |
| XLogP | 3.48 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|