C16H17ClN2O8S — CID 22850847
(5R,8S)-8-[(2-chloroacetyl)amino]-14,16-dihydroxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylic acid (PubChem CID 22850847) has the molecular formula C16H17ClN2O8S and a molecular weight of 432.84 g/mol. Its IUPAC name is (5R,8S)-8-[(2-chloroacetyl)amino]-14,16-dihydroxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylic acid.
| Compound Name | (5R,8S)-8-[(2-chloroacetyl)amino]-14,16-dihydroxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 22850847 |
| Molecular Formula | C16H17ClN2O8S |
| Molecular Weight | 432.84 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | (5R,8S)-8-[(2-chloroacetyl)amino]-14,16-dihydroxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylic acid |
| SMILES | O=C(CCl)N[C@H]1COC(=O)c2cc(O)cc(O)c2CSC[C@@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C16H17ClN2O8S/c17-3-13(22)18-10-4-27-16(26)8-1-7(20)2-12(21)9(8)5-28-6-11(15(24)25)19-14(10)23/h1-2,10-11,20-21H,3-6H2,(H,18,22)(H,19,23)(H,24,25)/t10-,11-/m0/s1 |
| InChIKey | TTZBSWBOOUMTRX-QWRGUYRKSA-N |
| XLogP | -0.21 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.84 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|