C26H46O6 — CID 22851092
(4aS,6R,7R,7aS)-4a-methoxy-2,2-dimethyl-7-[(E)-oct-2-enoxy]-6-[[(E)-oct-2-enoxy]methyl]-4,6,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine (PubChem CID 22851092) has the molecular formula C26H46O6 and a molecular weight of 454.65 g/mol. Its IUPAC name is (4aS,6R,7R,7aS)-4a-methoxy-2,2-dimethyl-7-[(E)-oct-2-enoxy]-6-[[(E)-oct-2-enoxy]methyl]-4,6,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine.
| Compound Name | (4aS,6R,7R,7aS)-4a-methoxy-2,2-dimethyl-7-[(E)-oct-2-enoxy]-6-[[(E)-oct-2-enoxy]methyl]-4,6,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 22851092 |
| Molecular Formula | C26H46O6 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | (4aS,6R,7R,7aS)-4a-methoxy-2,2-dimethyl-7-[(E)-oct-2-enoxy]-6-[[(E)-oct-2-enoxy]methyl]-4,6,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine |
| SMILES | CCCCC/C=C/COC[C@H]1O[C@@]2(OC)COC(C)(C)O[C@H]2[C@@H]1OC/C=C/CCCCC |
| InChI | InChI=1S/C26H46O6/c1-6-8-10-12-14-16-18-28-20-22-23(29-19-17-15-13-11-9-7-2)24-26(27-5,31-22)21-30-25(3,4)32-24/h14-17,22-24H,6-13,18-21H2,1-5H3/b16-14+,17-15+/t22-,23-,24+,26+/m1/s1 |
| InChIKey | WUYQVJCSISSKAS-HREURQDFSA-N |
| XLogP | 5.55 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|