C14H26O6 — CID 22851144
(2R)-2-hydroxy-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]dec-9-enal (PubChem CID 22851144) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]dec-9-enal.
| Compound Name | (2R)-2-hydroxy-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]dec-9-enal |
|---|---|
| PubChem CID | 22851144 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (2R)-2-hydroxy-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]dec-9-enal |
| SMILES | C=CCCCCCC[C@](O)(C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H26O6/c1-2-3-4-5-6-7-8-14(20,10-16)13(19)12(18)11(17)9-15/h2,10-13,15,17-20H,1,3-9H2/t11-,12-,13+,14+/m1/s1 |
| InChIKey | OHSHZJLTRJOEAM-MQYQWHSLSA-N |
| XLogP | -0.48 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|