About [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum
[(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum (PubChem CID 22852080) has the molecular formula C5H12I2N2O2Pt
and a molecular weight of 581.05 g/mol. Its IUPAC name is [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum.
Molecular Properties
| Compound Name | [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum |
| PubChem CID | 22852080 |
| Molecular Formula | C5H12I2N2O2Pt |
| Molecular Weight | 581.05 g/mol |
| Exact Mass | 580.86 |
| IUPAC Name | [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum |
| SMILES | I[Pt]I.NC[C@@H]1OCO[C@H]1CN |
| InChI | InChI=1S/C5H12N2O2.2HI.Pt/c6-1-4-5(2-7)9-3-8-4;;;/h4-5H,1-3,6-7H2;2*1H;/q;;;+2/p-2/t4-,5-;;;/m0.../s1 |
| InChIKey | OVEHGZJCZJJPEI-GYZVSSBESA-L |
| XLogP | 0.41 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 581.05 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum?
The IUPAC name of [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum (CID 22852080) is [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum.
What is the SMILES notation for [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum?
The canonical SMILES for [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum is I[Pt]I.NC[C@@H]1OCO[C@H]1CN.
What is the InChIKey of [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum?
The InChIKey is OVEHGZJCZJJPEI-GYZVSSBESA-L. The full InChI is InChI=1S/C5H12N2O2.2HI.Pt/c6-1-4-5(2-7)9-3-8-4;;;/h4-5H,1-3,6-7H2;2*1H;/q;;;+2/p-2/t4-,5-;;;/m0.../s1.
What are the key properties of [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum?
[(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum has a molecular weight of 581.05 g/mol, XLogP of 0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S,5S)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine;diiodoplatinum is sourced from PubChem (CID 22852080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).