C24H21FN2O2 — CID 22852210
methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-(4-fluorophenyl)propanoate (PubChem CID 22852210) has the molecular formula C24H21FN2O2 and a molecular weight of 388.44 g/mol. Its IUPAC name is methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-(4-fluorophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 22852210 |
| Molecular Formula | C24H21FN2O2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-(4-fluorophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(F)cc1)NCc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C24H21FN2O2/c1-29-24(28)23(14-17-8-12-21(25)13-9-17)27-16-18-6-10-19(11-7-18)22-5-3-2-4-20(22)15-26/h2-13,23,27H,14,16H2,1H3/t23-/m0/s1 |
| InChIKey | VSUJKQQVYLGFOI-QHCPKHFHSA-N |
| XLogP | 4.24 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |