C24H36N2O9SSi — CID 22852285
[(5R,8R,9R)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-5-methoxycarbonyl-9-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-trien-8-yl]carbamic acid (PubChem CID 22852285) has the molecular formula C24H36N2O9SSi and a molecular weight of 556.71 g/mol. Its IUPAC name is [(5R,8R,9R)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-5-methoxycarbonyl-9-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-trien-8-yl]carbamic acid.
| Compound Name | [(5R,8R,9R)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-5-methoxycarbonyl-9-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-trien-8-yl]carbamic acid |
|---|---|
| PubChem CID | 22852285 |
| Molecular Formula | C24H36N2O9SSi |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | [(5R,8R,9R)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-5-methoxycarbonyl-9-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-trien-8-yl]carbamic acid |
| SMILES | COC(=O)[C@@H]1CSCc2c(O[Si](C)(C)C(C)(C)C)cc(OC)cc2C(=O)O[C@H](C)[C@@H](NC(=O)O)C(=O)N1 |
| InChI | InChI=1S/C24H36N2O9SSi/c1-13-19(26-23(30)31)20(27)25-17(22(29)33-6)12-36-11-16-15(21(28)34-13)9-14(32-5)10-18(16)35-37(7,8)24(2,3)4/h9-10,13,17,19,26H,11-12H2,1-8H3,(H,25,27)(H,30,31)/t13-,17+,19-/m1/s1 |
| InChIKey | WNYNBRZUIFRENM-XVGQJIODSA-N |
| XLogP | 3.17 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|