C17H23NO4 — CID 22852317
(2S,3R,4S,5S)-5-(naphthalen-2-ylmethylamino)hexane-1,2,3,4-tetrol (PubChem CID 22852317) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-(naphthalen-2-ylmethylamino)hexane-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4S,5S)-5-(naphthalen-2-ylmethylamino)hexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 22852317 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (2S,3R,4S,5S)-5-(naphthalen-2-ylmethylamino)hexane-1,2,3,4-tetrol |
| SMILES | C[C@H](NCc1ccc2ccccc2c1)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C17H23NO4/c1-11(16(21)17(22)15(20)10-19)18-9-12-6-7-13-4-2-3-5-14(13)8-12/h2-8,11,15-22H,9-10H2,1H3/t11-,15-,16-,17-/m0/s1 |
| InChIKey | PFVBBHQOPMMXLT-SPOWBLRKSA-N |
| XLogP | 0.39 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |