C10H23NO4 — CID 22852318
(2S,3R,4S,5S)-5-(butylamino)hexane-1,2,3,4-tetrol (PubChem CID 22852318) has the molecular formula C10H23NO4 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-(butylamino)hexane-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4S,5S)-5-(butylamino)hexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 22852318 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (2S,3R,4S,5S)-5-(butylamino)hexane-1,2,3,4-tetrol |
| SMILES | CCCCN[C@@H](C)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H23NO4/c1-3-4-5-11-7(2)9(14)10(15)8(13)6-12/h7-15H,3-6H2,1-2H3/t7-,8-,9-,10-/m0/s1 |
| InChIKey | MQCRXLDKLFWMHI-XKNYDFJKSA-N |
| XLogP | -1.16 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|