C21H36O5Si — CID 22852553
ethyl (1S,3aR,6aR)-5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-2-oxo-3,3a,6,6a-tetrahydro-1H-pentalene-1-carboxylate (PubChem CID 22852553) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is ethyl (1S,3aR,6aR)-5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-2-oxo-3,3a,6,6a-tetrahydro-1H-pentalene-1-carboxylate.
| Compound Name | ethyl (1S,3aR,6aR)-5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-2-oxo-3,3a,6,6a-tetrahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 22852553 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | ethyl (1S,3aR,6aR)-5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-2-oxo-3,3a,6,6a-tetrahydro-1H-pentalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C[C@H]2C=C(CCOCCO[Si](C)(C)C(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C21H36O5Si/c1-7-25-20(23)19-17-13-15(12-16(17)14-18(19)22)8-9-24-10-11-26-27(5,6)21(2,3)4/h12,16-17,19H,7-11,13-14H2,1-6H3/t16-,17-,19+/m1/s1 |
| InChIKey | FYIACLQHCUWRGA-LMMKCTJWSA-N |
| XLogP | 4.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|