C22H40O4Si — CID 22852582
[(1R,2S,3aR,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(oxan-2-yloxy)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]methanol (PubChem CID 22852582) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is [(1R,2S,3aR,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(oxan-2-yloxy)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]methanol.
| Compound Name | [(1R,2S,3aR,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(oxan-2-yloxy)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]methanol |
|---|---|
| PubChem CID | 22852582 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | [(1R,2S,3aR,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(oxan-2-yloxy)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1=C[C@@H]2C[C@H](OC3CCCCO3)[C@@H](CO)[C@@H]2C1 |
| InChI | InChI=1S/C22H40O4Si/c1-22(2,3)27(4,5)25-11-9-16-12-17-14-20(19(15-23)18(17)13-16)26-21-8-6-7-10-24-21/h12,17-21,23H,6-11,13-15H2,1-5H3/t17-,18-,19+,20+,21?/m1/s1 |
| InChIKey | GQUVOSCQXSHFGG-AUGMSIGLSA-N |
| XLogP | 4.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|