C16H28O2Si — CID 22852583
(3aS,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3a,4,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 22852583) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is (3aS,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3a,4,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | (3aS,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3a,4,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 22852583 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (3aS,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3a,4,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1=C[C@@H]2CC(=O)C[C@@H]2C1 |
| InChI | InChI=1S/C16H28O2Si/c1-16(2,3)19(4,5)18-7-6-12-8-13-10-15(17)11-14(13)9-12/h8,13-14H,6-7,9-11H2,1-5H3/t13-,14+/m1/s1 |
| InChIKey | KVLNLSKNHFUVIR-KGLIPLIRSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|