C23H32O4 — CID 22852668
ethyl (1S,2S,3aR,6aR)-2-hydroxy-5-(5-phenylmethoxypentyl)-1,2,3,3a,6,6a-hexahydropentalene-1-carboxylate (PubChem CID 22852668) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is ethyl (1S,2S,3aR,6aR)-2-hydroxy-5-(5-phenylmethoxypentyl)-1,2,3,3a,6,6a-hexahydropentalene-1-carboxylate.
| Compound Name | ethyl (1S,2S,3aR,6aR)-2-hydroxy-5-(5-phenylmethoxypentyl)-1,2,3,3a,6,6a-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 22852668 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | ethyl (1S,2S,3aR,6aR)-2-hydroxy-5-(5-phenylmethoxypentyl)-1,2,3,3a,6,6a-hexahydropentalene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2CC(CCCCCOCc3ccccc3)=C[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C23H32O4/c1-2-27-23(25)22-20-14-18(13-19(20)15-21(22)24)11-7-4-8-12-26-16-17-9-5-3-6-10-17/h3,5-6,9-10,13,19-22,24H,2,4,7-8,11-12,14-16H2,1H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | DNAXXLDSXPNHDQ-CZYKHXBRSA-N |
| XLogP | 4.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|