C28H28N2O6 — CID 22853374
[1-[(2R,3S)-2,3-bis(4-methoxyphenyl)aziridin-2-yl]-2-(4-methoxyphenyl)-4-oxoazetidin-3-yl] acetate (PubChem CID 22853374) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is [1-[(2R,3S)-2,3-bis(4-methoxyphenyl)aziridin-2-yl]-2-(4-methoxyphenyl)-4-oxoazetidin-3-yl] acetate.
| Compound Name | [1-[(2R,3S)-2,3-bis(4-methoxyphenyl)aziridin-2-yl]-2-(4-methoxyphenyl)-4-oxoazetidin-3-yl] acetate |
|---|---|
| PubChem CID | 22853374 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [1-[(2R,3S)-2,3-bis(4-methoxyphenyl)aziridin-2-yl]-2-(4-methoxyphenyl)-4-oxoazetidin-3-yl] acetate |
| SMILES | COc1ccc(C2C(OC(C)=O)C(=O)N2[C@@]2(c3ccc(OC)cc3)N[C@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O6/c1-17(31)36-25-24(18-5-11-21(33-2)12-6-18)30(27(25)32)28(20-9-15-23(35-4)16-10-20)26(29-28)19-7-13-22(34-3)14-8-19/h5-16,24-26,29H,1-4H3/t24?,25?,26-,28+/m0/s1 |
| InChIKey | QPVMVKYJSVGSGJ-YJDMXYDHSA-N |
| XLogP | 3.72 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|