C10H21N — CID 22853538
trans-(1R,2S)-2-butan-2-ylcyclohexan-1-amine (PubChem CID 22853538) has the molecular formula C10H21N and a molecular weight of 155.29 g/mol. Its IUPAC name is trans-(1R,2S)-2-butan-2-ylcyclohexan-1-amine.
| Compound Name | trans-(1R,2S)-2-butan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 22853538 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.29 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | trans-(1R,2S)-2-butan-2-ylcyclohexan-1-amine |
| SMILES | CCC(C)[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C10H21N/c1-3-8(2)9-6-4-5-7-10(9)11/h8-10H,3-7,11H2,1-2H3/t8?,9-,10+/m0/s1 |
| InChIKey | AVLFPOZNTGDEJU-CBMCFHRWSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |