C25H38F2OS — CID 22853623
1-[2-[(8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethylsulfanyl]propan-2-ol (PubChem CID 22853623) has the molecular formula C25H38F2OS and a molecular weight of 424.64 g/mol. Its IUPAC name is 1-[2-[(8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethylsulfanyl]propan-2-ol.
| Compound Name | 1-[2-[(8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethylsulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 22853623 |
| Molecular Formula | C25H38F2OS |
| Molecular Weight | 424.64 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-[2-[(8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethylsulfanyl]propan-2-ol |
| SMILES | CC(O)CSCC[C@H]1[C@H](C)C[C@H]2[C@@H]3CC(F)C4=CCC=C[C@]4(C)[C@@]3(F)CC[C@]12C |
| InChI | InChI=1S/C25H38F2OS/c1-16-13-20-21-14-22(26)19-7-5-6-9-24(19,4)25(21,27)11-10-23(20,3)18(16)8-12-29-15-17(2)28/h6-7,9,16-18,20-22,28H,5,8,10-15H2,1-4H3/t16-,17?,18+,20+,21+,22?,23-,24+,25-/m1/s1 |
| InChIKey | PNHJZVFWVBWYLW-GPUHUEBTSA-N |
| XLogP | 6.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|