C25H36F2S — CID 22853625
(8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-17-(2-prop-2-enylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 22853625) has the molecular formula C25H36F2S and a molecular weight of 406.63 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-17-(2-prop-2-enylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-17-(2-prop-2-enylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22853625 |
| Molecular Formula | C25H36F2S |
| Molecular Weight | 406.63 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-17-(2-prop-2-enylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=CCSCC[C@H]1[C@H](C)C[C@H]2[C@@H]3CC(F)C4=CCC=C[C@]4(C)[C@@]3(F)CC[C@]12C |
| InChI | InChI=1S/C25H36F2S/c1-5-13-28-14-9-18-17(2)15-20-21-16-22(26)19-8-6-7-10-24(19,4)25(21,27)12-11-23(18,20)3/h5,7-8,10,17-18,20-22H,1,6,9,11-16H2,2-4H3/t17-,18+,20+,21+,22?,23-,24+,25-/m1/s1 |
| InChIKey | LFPQROAQBDILEP-OUDLZFEMSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.63 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|