C23H34F2S — CID 22853626
(8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-17-(2-methylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 22853626) has the molecular formula C23H34F2S and a molecular weight of 380.59 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-17-(2-methylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-17-(2-methylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22853626 |
| Molecular Formula | C23H34F2S |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (8S,9R,10S,13R,14S,16R,17S)-6,9-difluoro-10,13,16-trimethyl-17-(2-methylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CSCC[C@H]1[C@H](C)C[C@H]2[C@@H]3CC(F)C4=CCC=C[C@]4(C)[C@@]3(F)CC[C@]12C |
| InChI | InChI=1S/C23H34F2S/c1-15-13-18-19-14-20(24)17-7-5-6-9-22(17,3)23(19,25)11-10-21(18,2)16(15)8-12-26-4/h6-7,9,15-16,18-20H,5,8,10-14H2,1-4H3/t15-,16+,18+,19+,20?,21-,22+,23-/m1/s1 |
| InChIKey | FMZGNHIWILLJBE-NTFNZTMYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|