C28H45FS2 — CID 22853633
(8S,9R,10S,13R,14S,16R,17S)-17-[2-(2-tert-butylsulfanylethylsulfanyl)ethyl]-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 22853633) has the molecular formula C28H45FS2 and a molecular weight of 464.80 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,16R,17S)-17-[2-(2-tert-butylsulfanylethylsulfanyl)ethyl]-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S,16R,17S)-17-[2-(2-tert-butylsulfanylethylsulfanyl)ethyl]-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22853633 |
| Molecular Formula | C28H45FS2 |
| Molecular Weight | 464.80 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (8S,9R,10S,13R,14S,16R,17S)-17-[2-(2-tert-butylsulfanylethylsulfanyl)ethyl]-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@@]3(F)CC[C@]2(C)[C@H]1CCSCCSC(C)(C)C |
| InChI | InChI=1S/C28H45FS2/c1-20-19-24-23-11-10-21-9-7-8-13-27(21,6)28(23,29)15-14-26(24,5)22(20)12-16-30-17-18-31-25(2,3)4/h8-9,13,20,22-24H,7,10-12,14-19H2,1-6H3/t20-,22+,23+,24+,26-,27+,28-/m1/s1 |
| InChIKey | OSFYECXFSCXXTB-BNWGMTCDSA-N |
| XLogP | 8.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.80 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|