C24H37FS — CID 22853637
(8S,9R,10S,13R,14S,16R,17S)-17-(2-ethylsulfanylethyl)-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 22853637) has the molecular formula C24H37FS and a molecular weight of 376.63 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,16R,17S)-17-(2-ethylsulfanylethyl)-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S,16R,17S)-17-(2-ethylsulfanylethyl)-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22853637 |
| Molecular Formula | C24H37FS |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (8S,9R,10S,13R,14S,16R,17S)-17-(2-ethylsulfanylethyl)-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CCSCC[C@H]1[C@H](C)C[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@@]3(F)CC[C@]12C |
| InChI | InChI=1S/C24H37FS/c1-5-26-15-11-19-17(2)16-21-20-10-9-18-8-6-7-12-23(18,4)24(20,25)14-13-22(19,21)3/h7-8,12,17,19-21H,5-6,9-11,13-16H2,1-4H3/t17-,19+,20+,21+,22-,23+,24-/m1/s1 |
| InChIKey | XCFYGVSUOWYCOF-XHPIFXCPSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|