C25H39FS — CID 22853639
(8S,9R,10S,13R,14S,16R,17S)-9-fluoro-10,13,16-trimethyl-17-(2-propan-2-ylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 22853639) has the molecular formula C25H39FS and a molecular weight of 390.65 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,16R,17S)-9-fluoro-10,13,16-trimethyl-17-(2-propan-2-ylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S,16R,17S)-9-fluoro-10,13,16-trimethyl-17-(2-propan-2-ylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22853639 |
| Molecular Formula | C25H39FS |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (8S,9R,10S,13R,14S,16R,17S)-9-fluoro-10,13,16-trimethyl-17-(2-propan-2-ylsulfanylethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CC(C)SCC[C@H]1[C@H](C)C[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@@]3(F)CC[C@]12C |
| InChI | InChI=1S/C25H39FS/c1-17(2)27-15-11-20-18(3)16-22-21-10-9-19-8-6-7-12-24(19,5)25(21,26)14-13-23(20,22)4/h7-8,12,17-18,20-22H,6,9-11,13-16H2,1-5H3/t18-,20+,21+,22+,23-,24+,25-/m1/s1 |
| InChIKey | PUHWDQVOVVQIIX-JBQPKLDBSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|