C26H41F3O5S — CID 22853861
[(3S,5R,10S,13S,14S)-3,14-bis(ethoxymethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate (PubChem CID 22853861) has the molecular formula C26H41F3O5S and a molecular weight of 522.67 g/mol. Its IUPAC name is [(3S,5R,10S,13S,14S)-3,14-bis(ethoxymethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate.
| Compound Name | [(3S,5R,10S,13S,14S)-3,14-bis(ethoxymethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22853861 |
| Molecular Formula | C26H41F3O5S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | [(3S,5R,10S,13S,14S)-3,14-bis(ethoxymethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
| SMILES | CCOC[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@]4(COCC)C3CC[C@@H]2C1 |
| InChI | InChI=1S/C26H41F3O5S/c1-5-32-16-18-9-12-23(3)19(15-18)7-8-21-20(23)10-13-24(4)22(34-35(30,31)26(27,28)29)11-14-25(21,24)17-33-6-2/h11,18-21H,5-10,12-17H2,1-4H3/t18-,19+,20?,21?,23-,24+,25-/m0/s1 |
| InChIKey | KFPKVWIZDBCKEB-HFTQUUJFSA-N |
| XLogP | 6.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|