C28H33F3O6S — CID 22853996
[4-[(8R,9S,10R,11S,13S,17S)-17-hydroxy-13,17-dimethylspiro[1,2,4,7,8,9,10,11,12,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-yl]phenyl] trifluoromethanesulfonate (PubChem CID 22853996) has the molecular formula C28H33F3O6S and a molecular weight of 554.63 g/mol. Its IUPAC name is [4-[(8R,9S,10R,11S,13S,17S)-17-hydroxy-13,17-dimethylspiro[1,2,4,7,8,9,10,11,12,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(8R,9S,10R,11S,13S,17S)-17-hydroxy-13,17-dimethylspiro[1,2,4,7,8,9,10,11,12,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22853996 |
| Molecular Formula | C28H33F3O6S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | [4-[(8R,9S,10R,11S,13S,17S)-17-hydroxy-13,17-dimethylspiro[1,2,4,7,8,9,10,11,12,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-yl]phenyl] trifluoromethanesulfonate |
| SMILES | C[C@]1(O)CC=C2[C@@H]3CC=C4CC5(CC[C@@H]4[C@H]3[C@@H](c3ccc(OS(=O)(=O)C(F)(F)F)cc3)C[C@@]21C)OCCO5 |
| InChI | InChI=1S/C28H33F3O6S/c1-25-16-22(17-3-6-19(7-4-17)37-38(33,34)28(29,30)31)24-20-9-12-27(35-13-14-36-27)15-18(20)5-8-21(24)23(25)10-11-26(25,2)32/h3-7,10,20-22,24,32H,8-9,11-16H2,1-2H3/t20-,21-,22+,24+,25-,26-/m0/s1 |
| InChIKey | DZIGMLUNGPCKHZ-AJDITRHRSA-N |
| XLogP | 5.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|