C6H15O24P3S3 — CID 22854643
[(1R,3S,4R,6S)-2,3-diphosphonooxy-4,5,6-trisulfooxycyclohexyl] dihydrogen phosphate (PubChem CID 22854643) has the molecular formula C6H15O24P3S3 and a molecular weight of 660.29 g/mol. Its IUPAC name is [(1R,3S,4R,6S)-2,3-diphosphonooxy-4,5,6-trisulfooxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(1R,3S,4R,6S)-2,3-diphosphonooxy-4,5,6-trisulfooxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 22854643 |
| Molecular Formula | C6H15O24P3S3 |
| Molecular Weight | 660.29 g/mol |
| Exact Mass | 659.83 |
| IUPAC Name | [(1R,3S,4R,6S)-2,3-diphosphonooxy-4,5,6-trisulfooxycyclohexyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1[C@@H](OP(=O)(O)O)[C@H](OS(=O)(=O)O)C(OS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C6H15O24P3S3/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H,16,17,18)(H,19,20,21)(H,22,23,24)/t1?,2-,3+,4+,5-,6? |
| InChIKey | FMGOTFJOMQSLIP-UYSNGIAKSA-N |
| XLogP | -4.00 |
| TPSA | 391.08 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.29 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|