C18H25F7NO+ — CID 2285495
(2R)-1-[(2R,6S)-2,6-bis(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]-3,3,4,4,5,5,5-heptafluoropentan-2-ol (PubChem CID 2285495) has the molecular formula C18H25F7NO+ and a molecular weight of 404.39 g/mol. Its IUPAC name is (2R)-1-[(2R,6S)-2,6-bis(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]-3,3,4,4,5,5,5-heptafluoropentan-2-ol.
| Compound Name | (2R)-1-[(2R,6S)-2,6-bis(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]-3,3,4,4,5,5,5-heptafluoropentan-2-ol |
|---|---|
| PubChem CID | 2285495 |
| Molecular Formula | C18H25F7NO+ |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (2R)-1-[(2R,6S)-2,6-bis(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]-3,3,4,4,5,5,5-heptafluoropentan-2-ol |
| SMILES | C=C(C)C[C@H]1CC=C[C@H](CC(=C)C)[NH+]1C[C@@H](O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H24F7NO/c1-11(2)8-13-6-5-7-14(9-12(3)4)26(13)10-15(27)16(19,20)17(21,22)18(23,24)25/h5-6,13-15,27H,1,3,7-10H2,2,4H3/p+1/t13-,14-,15-/m1/s1 |
| InChIKey | DGSKIQFMHNWEFR-RBSFLKMASA-O |
| XLogP | 3.69 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|