C29H33NO4 — CID 22855096
(3aS,4S,5S,6R,7aS)-1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole (PubChem CID 22855096) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is (3aS,4S,5S,6R,7aS)-1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole.
| Compound Name | (3aS,4S,5S,6R,7aS)-1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
|---|---|
| PubChem CID | 22855096 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (3aS,4S,5S,6R,7aS)-1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
| SMILES | CN1OC[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)C(OCc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C29H33NO4/c1-30-26-17-27(31-18-22-11-5-2-6-12-22)29(33-20-24-15-9-4-10-16-24)28(25(26)21-34-30)32-19-23-13-7-3-8-14-23/h2-16,25-29H,17-21H2,1H3/t25-,26+,27?,28+,29+/m1/s1 |
| InChIKey | OTNOTKJBNCAJLD-QRGVUDOSSA-N |
| XLogP | 5.01 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |