C12H10F5NO2 — CID 22855167
N-[(1S)-5,7-difluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 22855167) has the molecular formula C12H10F5NO2 and a molecular weight of 295.21 g/mol. Its IUPAC name is N-[(1S)-5,7-difluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S)-5,7-difluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 22855167 |
| Molecular Formula | C12H10F5NO2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-[(1S)-5,7-difluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC1CCc2c(F)cc(F)cc2[C@@H]1O)C(F)(F)F |
| InChI | InChI=1S/C12H10F5NO2/c13-5-3-7-6(8(14)4-5)1-2-9(10(7)19)18-11(20)12(15,16)17/h3-4,9-10,19H,1-2H2,(H,18,20)/t9?,10-/m0/s1 |
| InChIKey | DIVCCPPQRPOMCG-AXDSSHIGSA-N |
| XLogP | 1.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |