C12H18N2O2 — CID 22855274
N-[(1S,2S)-2-(prop-2-enoylamino)cyclohexyl]prop-2-enamide (PubChem CID 22855274) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-[(1S,2S)-2-(prop-2-enoylamino)cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1S,2S)-2-(prop-2-enoylamino)cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 22855274 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-[(1S,2S)-2-(prop-2-enoylamino)cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCCC[C@@H]1NC(=O)C=C |
| InChI | InChI=1S/C12H18N2O2/c1-3-11(15)13-9-7-5-6-8-10(9)14-12(16)4-2/h3-4,9-10H,1-2,5-8H2,(H,13,15)(H,14,16)/t9-,10-/m0/s1 |
| InChIKey | QVKYBBRAIXBKAX-UWVGGRQHSA-N |
| XLogP | 0.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|