C13H19FO4 — CID 22855754
[3-fluoro-5-[(1S,2R)-1,2,3-trimethoxypropyl]phenyl]methanol (PubChem CID 22855754) has the molecular formula C13H19FO4 and a molecular weight of 258.29 g/mol. Its IUPAC name is [3-fluoro-5-[(1S,2R)-1,2,3-trimethoxypropyl]phenyl]methanol.
| Compound Name | [3-fluoro-5-[(1S,2R)-1,2,3-trimethoxypropyl]phenyl]methanol |
|---|---|
| PubChem CID | 22855754 |
| Molecular Formula | C13H19FO4 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [3-fluoro-5-[(1S,2R)-1,2,3-trimethoxypropyl]phenyl]methanol |
| SMILES | COC[C@@H](OC)[C@@H](OC)c1cc(F)cc(CO)c1 |
| InChI | InChI=1S/C13H19FO4/c1-16-8-12(17-2)13(18-3)10-4-9(7-15)5-11(14)6-10/h4-6,12-13,15H,7-8H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | NRTDDMDTBOXPMH-OLZOCXBDSA-N |
| XLogP | 1.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |