C19H36O4 — CID 22855983
(2S,3R,4R,5R)-5-butoxy-4-methoxy-2-[(E)-non-1-enyl]oxan-3-ol (PubChem CID 22855983) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-butoxy-4-methoxy-2-[(E)-non-1-enyl]oxan-3-ol.
| Compound Name | (2S,3R,4R,5R)-5-butoxy-4-methoxy-2-[(E)-non-1-enyl]oxan-3-ol |
|---|---|
| PubChem CID | 22855983 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | (2S,3R,4R,5R)-5-butoxy-4-methoxy-2-[(E)-non-1-enyl]oxan-3-ol |
| SMILES | CCCCCCC/C=C/[C@@H]1OC[C@@H](OCCCC)[C@H](OC)[C@@H]1O |
| InChI | InChI=1S/C19H36O4/c1-4-6-8-9-10-11-12-13-16-18(20)19(21-3)17(15-23-16)22-14-7-5-2/h12-13,16-20H,4-11,14-15H2,1-3H3/b13-12+/t16-,17+,18+,19-/m0/s1 |
| InChIKey | RZXXAFIPJZQWOR-KENJKRGESA-N |
| XLogP | 3.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|