C20H36O4 — CID 22855989
(3S,4S,5R,8S)-5-butoxy-4-methoxy-8-[(E)-non-1-enyl]-1,7-dioxaspiro[2.5]octane (PubChem CID 22855989) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is (3S,4S,5R,8S)-5-butoxy-4-methoxy-8-[(E)-non-1-enyl]-1,7-dioxaspiro[2.5]octane.
| Compound Name | (3S,4S,5R,8S)-5-butoxy-4-methoxy-8-[(E)-non-1-enyl]-1,7-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 22855989 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (3S,4S,5R,8S)-5-butoxy-4-methoxy-8-[(E)-non-1-enyl]-1,7-dioxaspiro[2.5]octane |
| SMILES | CCCCCCC/C=C/[C@@H]1OC[C@@H](OCCCC)[C@H](OC)[C@]12CO2 |
| InChI | InChI=1S/C20H36O4/c1-4-6-8-9-10-11-12-13-18-20(16-24-20)19(21-3)17(15-23-18)22-14-7-5-2/h12-13,17-19H,4-11,14-16H2,1-3H3/b13-12+/t17-,18+,19+,20+/m1/s1 |
| InChIKey | IPYASPQWABQHTR-MZRDXZDZSA-N |
| XLogP | 4.27 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|