C16H28O3 — CID 22855996
(3S,4S,5S,8S)-4-methoxy-5-methyl-8-[(E)-oct-1-enyl]-1,7-dioxaspiro[2.5]octane (PubChem CID 22855996) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (3S,4S,5S,8S)-4-methoxy-5-methyl-8-[(E)-oct-1-enyl]-1,7-dioxaspiro[2.5]octane.
| Compound Name | (3S,4S,5S,8S)-4-methoxy-5-methyl-8-[(E)-oct-1-enyl]-1,7-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 22855996 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (3S,4S,5S,8S)-4-methoxy-5-methyl-8-[(E)-oct-1-enyl]-1,7-dioxaspiro[2.5]octane |
| SMILES | CCCCCC/C=C/[C@@H]1OC[C@H](C)[C@H](OC)[C@@]12CO2 |
| InChI | InChI=1S/C16H28O3/c1-4-5-6-7-8-9-10-14-16(12-19-16)15(17-3)13(2)11-18-14/h9-10,13-15H,4-8,11-12H2,1-3H3/b10-9+/t13-,14-,15-,16+/m0/s1 |
| InChIKey | MWBXHPVDPOYJGF-XHZXXIAGSA-N |
| XLogP | 3.33 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|